C14H16ClN3 — CID 103163943
4-(3-chlorophenyl)-5-(cyclobutylmethyl)-1H-pyrazol-3-amine (PubChem CID 103163943) has the molecular formula C14H16ClN3 and a molecular weight of 261.76 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-5-(cyclobutylmethyl)-1H-pyrazol-3-amine.
| Compound Name | 4-(3-chlorophenyl)-5-(cyclobutylmethyl)-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 103163943 |
| Molecular Formula | C14H16ClN3 |
| Molecular Weight | 261.76 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 4-(3-chlorophenyl)-5-(cyclobutylmethyl)-1H-pyrazol-3-amine |
| SMILES | Nc1n[nH]c(CC2CCC2)c1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H16ClN3/c15-11-6-2-5-10(8-11)13-12(17-18-14(13)16)7-9-3-1-4-9/h2,5-6,8-9H,1,3-4,7H2,(H3,16,17,18) |
| InChIKey | OKWMIUSBGWOJKK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.76 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |