C17H23N3 — CID 62829434
5-cycloheptyl-4-(4-methylphenyl)-1H-pyrazol-3-amine (PubChem CID 62829434) has the molecular formula C17H23N3 and a molecular weight of 269.39 g/mol. Its IUPAC name is 5-cycloheptyl-4-(4-methylphenyl)-1H-pyrazol-3-amine.
| Compound Name | 5-cycloheptyl-4-(4-methylphenyl)-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 62829434 |
| Molecular Formula | C17H23N3 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 5-cycloheptyl-4-(4-methylphenyl)-1H-pyrazol-3-amine |
| SMILES | Cc1ccc(-c2c(N)n[nH]c2C2CCCCCC2)cc1 |
| InChI | InChI=1S/C17H23N3/c1-12-8-10-13(11-9-12)15-16(19-20-17(15)18)14-6-4-2-3-5-7-14/h8-11,14H,2-7H2,1H3,(H3,18,19,20) |
| InChIKey | PRVPYEAIIASAKP-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |