C15H18BrN6O+ — CID 118559025
4-(4-amino-3-bromoimidazo[1,5-a]pyrazin-4-ium-1-yl)-1-ethyl-6,7-dihydro-5H-indazol-4-ol (PubChem CID 118559025) has the molecular formula C15H18BrN6O+ and a molecular weight of 378.25 g/mol. Its IUPAC name is 4-(4-amino-3-bromoimidazo[1,5-a]pyrazin-4-ium-1-yl)-1-ethyl-6,7-dihydro-5H-indazol-4-ol.
| Compound Name | 4-(4-amino-3-bromoimidazo[1,5-a]pyrazin-4-ium-1-yl)-1-ethyl-6,7-dihydro-5H-indazol-4-ol |
|---|---|
| PubChem CID | 118559025 |
| Molecular Formula | C15H18BrN6O+ |
| Molecular Weight | 378.25 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 4-(4-amino-3-bromoimidazo[1,5-a]pyrazin-4-ium-1-yl)-1-ethyl-6,7-dihydro-5H-indazol-4-ol |
| SMILES | CCn1ncc2c1CCCC2(O)C1=C2C=NC=C[N+]2(N)C(Br)=N1 |
| InChI | InChI=1S/C15H18BrN6O/c1-2-21-11-4-3-5-15(23,10(11)8-19-21)13-12-9-18-6-7-22(12,17)14(16)20-13/h6-9,23H,2-5,17H2,1H3/q+1 |
| InChIKey | YCBAXBHOBMPJCN-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|