C31H33NO4 — CID 118563032
(2S)-2-[2-(3,4-dihydro-2H-chromen-6-yl)-1,4,6-trimethylphenanthridin-3-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid (PubChem CID 118563032) has the molecular formula C31H33NO4 and a molecular weight of 483.61 g/mol. Its IUPAC name is (2S)-2-[2-(3,4-dihydro-2H-chromen-6-yl)-1,4,6-trimethylphenanthridin-3-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid.
| Compound Name | (2S)-2-[2-(3,4-dihydro-2H-chromen-6-yl)-1,4,6-trimethylphenanthridin-3-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid |
|---|---|
| PubChem CID | 118563032 |
| Molecular Formula | C31H33NO4 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | (2S)-2-[2-(3,4-dihydro-2H-chromen-6-yl)-1,4,6-trimethylphenanthridin-3-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid |
| SMILES | Cc1nc2c(C)c([C@H](OC(C)(C)C)C(=O)O)c(-c3ccc4c(c3)CCCO4)c(C)c2c2ccccc12 |
| InChI | InChI=1S/C31H33NO4/c1-17-25(21-13-14-24-20(16-21)10-9-15-35-24)27(29(30(33)34)36-31(4,5)6)18(2)28-26(17)23-12-8-7-11-22(23)19(3)32-28/h7-8,11-14,16,29H,9-10,15H2,1-6H3,(H,33,34)/t29-/m0/s1 |
| InChIKey | VRFLEXZVVUYDSN-LJAQVGFWSA-N |
| XLogP | 7.25 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|