C33H38N2O4S — CID 144960036
2-[5-(3,4-dihydro-2H-chromen-6-yl)-7-methyl-2-phenyl-10-thia-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid;ethane (PubChem CID 144960036) has the molecular formula C33H38N2O4S and a molecular weight of 558.74 g/mol. Its IUPAC name is 2-[5-(3,4-dihydro-2H-chromen-6-yl)-7-methyl-2-phenyl-10-thia-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid;ethane.
| Compound Name | 2-[5-(3,4-dihydro-2H-chromen-6-yl)-7-methyl-2-phenyl-10-thia-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid;ethane |
|---|---|
| PubChem CID | 144960036 |
| Molecular Formula | C33H38N2O4S |
| Molecular Weight | 558.74 g/mol |
| Exact Mass | 558.26 |
| IUPAC Name | 2-[5-(3,4-dihydro-2H-chromen-6-yl)-7-methyl-2-phenyl-10-thia-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid;ethane |
| SMILES | CC.Cc1c(C(OC(C)(C)C)C(=O)O)c(-c2ccc3c(c2)CCCO3)c2cc(-c3ccccc3)n3c2c1NSC3 |
| InChI | InChI=1S/C31H32N2O4S.C2H6/c1-18-25(29(30(34)35)37-31(2,3)4)26(21-12-13-24-20(15-21)11-8-14-36-24)22-16-23(19-9-6-5-7-10-19)33-17-38-32-27(18)28(22)33;1-2/h5-7,9-10,12-13,15-16,29,32H,8,11,14,17H2,1-4H3,(H,34,35);1-2H3 |
| InChIKey | YMUDXWOQCKRIIS-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.74 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|