C20H15N5O3 — CID 118567322
2-(6-methyl-1,3-dioxoisoindol-4-yl)-N-(6-pyridin-3-ylpyridazin-3-yl)acetamide (PubChem CID 118567322) has the molecular formula C20H15N5O3 and a molecular weight of 373.37 g/mol. Its IUPAC name is 2-(6-methyl-1,3-dioxoisoindol-4-yl)-N-(6-pyridin-3-ylpyridazin-3-yl)acetamide.
| Compound Name | 2-(6-methyl-1,3-dioxoisoindol-4-yl)-N-(6-pyridin-3-ylpyridazin-3-yl)acetamide |
|---|---|
| PubChem CID | 118567322 |
| Molecular Formula | C20H15N5O3 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 2-(6-methyl-1,3-dioxoisoindol-4-yl)-N-(6-pyridin-3-ylpyridazin-3-yl)acetamide |
| SMILES | Cc1cc(CC(=O)Nc2ccc(-c3cccnc3)nn2)c2c(c1)C(=O)NC2=O |
| InChI | InChI=1S/C20H15N5O3/c1-11-7-13(18-14(8-11)19(27)23-20(18)28)9-17(26)22-16-5-4-15(24-25-16)12-3-2-6-21-10-12/h2-8,10H,9H2,1H3,(H,22,25,26)(H,23,27,28) |
| InChIKey | RHUJFCNDHOGYSB-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|