C22H17FN4O3 — CID 118560694
2-(2,6-dimethyl-1,3-dioxoisoindol-4-yl)-N-[6-(2-fluorophenyl)pyridazin-3-yl]acetamide (PubChem CID 118560694) has the molecular formula C22H17FN4O3 and a molecular weight of 404.40 g/mol. Its IUPAC name is 2-(2,6-dimethyl-1,3-dioxoisoindol-4-yl)-N-[6-(2-fluorophenyl)pyridazin-3-yl]acetamide.
| Compound Name | 2-(2,6-dimethyl-1,3-dioxoisoindol-4-yl)-N-[6-(2-fluorophenyl)pyridazin-3-yl]acetamide |
|---|---|
| PubChem CID | 118560694 |
| Molecular Formula | C22H17FN4O3 |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 2-(2,6-dimethyl-1,3-dioxoisoindol-4-yl)-N-[6-(2-fluorophenyl)pyridazin-3-yl]acetamide |
| SMILES | Cc1cc(CC(=O)Nc2ccc(-c3ccccc3F)nn2)c2c(c1)C(=O)N(C)C2=O |
| InChI | InChI=1S/C22H17FN4O3/c1-12-9-13(20-15(10-12)21(29)27(2)22(20)30)11-19(28)24-18-8-7-17(25-26-18)14-5-3-4-6-16(14)23/h3-10H,11H2,1-2H3,(H,24,26,28) |
| InChIKey | DIYDKOKSVPRQSK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|