C26H18N4O3 — CID 118567306
2-(1,3-dioxo-2-phenylisoindol-4-yl)-N-(6-phenylpyridazin-3-yl)acetamide (PubChem CID 118567306) has the molecular formula C26H18N4O3 and a molecular weight of 434.46 g/mol. Its IUPAC name is 2-(1,3-dioxo-2-phenylisoindol-4-yl)-N-(6-phenylpyridazin-3-yl)acetamide.
| Compound Name | 2-(1,3-dioxo-2-phenylisoindol-4-yl)-N-(6-phenylpyridazin-3-yl)acetamide |
|---|---|
| PubChem CID | 118567306 |
| Molecular Formula | C26H18N4O3 |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 2-(1,3-dioxo-2-phenylisoindol-4-yl)-N-(6-phenylpyridazin-3-yl)acetamide |
| SMILES | O=C(Cc1cccc2c1C(=O)N(c1ccccc1)C2=O)Nc1ccc(-c2ccccc2)nn1 |
| InChI | InChI=1S/C26H18N4O3/c31-23(27-22-15-14-21(28-29-22)17-8-3-1-4-9-17)16-18-10-7-13-20-24(18)26(33)30(25(20)32)19-11-5-2-6-12-19/h1-15H,16H2,(H,27,29,31) |
| InChIKey | ASGFYEQWVFKEBC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|