C19H13F4N3O — CID 167957492
N-[6-(2-fluorophenyl)pyridazin-3-yl]-2-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 167957492) has the molecular formula C19H13F4N3O and a molecular weight of 375.33 g/mol. Its IUPAC name is N-[6-(2-fluorophenyl)pyridazin-3-yl]-2-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[6-(2-fluorophenyl)pyridazin-3-yl]-2-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 167957492 |
| Molecular Formula | C19H13F4N3O |
| Molecular Weight | 375.33 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | N-[6-(2-fluorophenyl)pyridazin-3-yl]-2-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(Cc1cccc(C(F)(F)F)c1)Nc1ccc(-c2ccccc2F)nn1 |
| InChI | InChI=1S/C19H13F4N3O/c20-15-7-2-1-6-14(15)16-8-9-17(26-25-16)24-18(27)11-12-4-3-5-13(10-12)19(21,22)23/h1-10H,11H2,(H,24,26,27) |
| InChIKey | UDEZXYFFLUWVLQ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.33 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |