C21H15F2N3O2S — CID 11856766
(5E)-5-[[3-(3,5-difluorophenyl)-1-phenylpyrazol-4-yl]methylidene]-3-ethyl-1,3-thiazolidine-2,4-dione (PubChem CID 11856766) has the molecular formula C21H15F2N3O2S and a molecular weight of 411.43 g/mol. Its IUPAC name is (5E)-5-[[3-(3,5-difluorophenyl)-1-phenylpyrazol-4-yl]methylidene]-3-ethyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3-(3,5-difluorophenyl)-1-phenylpyrazol-4-yl]methylidene]-3-ethyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 11856766 |
| Molecular Formula | C21H15F2N3O2S |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | (5E)-5-[[3-(3,5-difluorophenyl)-1-phenylpyrazol-4-yl]methylidene]-3-ethyl-1,3-thiazolidine-2,4-dione |
| SMILES | CCN1C(=O)S/C(=C/c2cn(-c3ccccc3)nc2-c2cc(F)cc(F)c2)C1=O |
| InChI | InChI=1S/C21H15F2N3O2S/c1-2-25-20(27)18(29-21(25)28)10-14-12-26(17-6-4-3-5-7-17)24-19(14)13-8-15(22)11-16(23)9-13/h3-12H,2H2,1H3/b18-10+ |
| InChIKey | QNCPIJQRGHOLCG-VCHYOVAHSA-N |
| XLogP | 4.87 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|