C26H18BrN3O2S — CID 46233285
(5Z)-3-[(3-bromophenyl)methyl]-5-[(1,3-diphenylpyrazol-4-yl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 46233285) has the molecular formula C26H18BrN3O2S and a molecular weight of 516.42 g/mol. Its IUPAC name is (5Z)-3-[(3-bromophenyl)methyl]-5-[(1,3-diphenylpyrazol-4-yl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-[(3-bromophenyl)methyl]-5-[(1,3-diphenylpyrazol-4-yl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 46233285 |
| Molecular Formula | C26H18BrN3O2S |
| Molecular Weight | 516.42 g/mol |
| Exact Mass | 515.03 |
| IUPAC Name | (5Z)-3-[(3-bromophenyl)methyl]-5-[(1,3-diphenylpyrazol-4-yl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C\c2cn(-c3ccccc3)nc2-c2ccccc2)C(=O)N1Cc1cccc(Br)c1 |
| InChI | InChI=1S/C26H18BrN3O2S/c27-21-11-7-8-18(14-21)16-29-25(31)23(33-26(29)32)15-20-17-30(22-12-5-2-6-13-22)28-24(20)19-9-3-1-4-10-19/h1-15,17H,16H2/b23-15- |
| InChIKey | MYMFPMHAXRBMGN-HAHDFKILSA-N |
| XLogP | 6.54 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.42 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|