About N-(5-benzyl-4-phenyl-1,3-thiazol-2-yl)-4-(3-bromo-4-ethoxyphenyl)-4-oxobutanamide
N-(5-benzyl-4-phenyl-1,3-thiazol-2-yl)-4-(3-bromo-4-ethoxyphenyl)-4-oxobutanamide (PubChem CID 11856778) has the molecular formula C28H25BrN2O3S
and a molecular weight of 549.49 g/mol. Its IUPAC name is N-(5-benzyl-4-phenyl-1,3-thiazol-2-yl)-4-(3-bromo-4-ethoxyphenyl)-4-oxobutanamide.
Molecular Properties
| Compound Name | N-(5-benzyl-4-phenyl-1,3-thiazol-2-yl)-4-(3-bromo-4-ethoxyphenyl)-4-oxobutanamide |
| PubChem CID | 11856778 |
| Molecular Formula | C28H25BrN2O3S |
| Molecular Weight | 549.49 g/mol |
| Exact Mass | 548.08 |
| IUPAC Name | N-(5-benzyl-4-phenyl-1,3-thiazol-2-yl)-4-(3-bromo-4-ethoxyphenyl)-4-oxobutanamide |
| SMILES | CCOc1ccc(C(=O)CCC(=O)Nc2nc(-c3ccccc3)c(Cc3ccccc3)s2)cc1Br |
| InChI | InChI=1S/C28H25BrN2O3S/c1-2-34-24-15-13-21(18-22(24)29)23(32)14-16-26(33)30-28-31-27(20-11-7-4-8-12-20)25(35-28)17-19-9-5-3-6-10-19/h3-13,15,18H,2,14,16-17H2,1H3,(H,30,31,33) |
| InChIKey | QPUPPWIJBIEASD-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 549.49 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(5-benzyl-4-phenyl-1,3-thiazol-2-yl)-4-(3-bromo-4-ethoxyphenyl)-4-oxobutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-benzyl-4-phenyl-1,3-thiazol-2-yl)-4-(3-bromo-4-ethoxyphenyl)-4-oxobutanamide?
The IUPAC name of N-(5-benzyl-4-phenyl-1,3-thiazol-2-yl)-4-(3-bromo-4-ethoxyphenyl)-4-oxobutanamide (CID 11856778) is N-(5-benzyl-4-phenyl-1,3-thiazol-2-yl)-4-(3-bromo-4-ethoxyphenyl)-4-oxobutanamide.
What is the SMILES notation for N-(5-benzyl-4-phenyl-1,3-thiazol-2-yl)-4-(3-bromo-4-ethoxyphenyl)-4-oxobutanamide?
The canonical SMILES for N-(5-benzyl-4-phenyl-1,3-thiazol-2-yl)-4-(3-bromo-4-ethoxyphenyl)-4-oxobutanamide is CCOc1ccc(C(=O)CCC(=O)Nc2nc(-c3ccccc3)c(Cc3ccccc3)s2)cc1Br.
What is the InChIKey of N-(5-benzyl-4-phenyl-1,3-thiazol-2-yl)-4-(3-bromo-4-ethoxyphenyl)-4-oxobutanamide?
The InChIKey is QPUPPWIJBIEASD-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H25BrN2O3S/c1-2-34-24-15-13-21(18-22(24)29)23(32)14-16-26(33)30-28-31-27(20-11-7-4-8-12-20)25(35-28)17-19-9-5-3-6-10-19/h3-13,15,18H,2,14,16-17H2,1H3,(H,30,31,33).
What are the key properties of N-(5-benzyl-4-phenyl-1,3-thiazol-2-yl)-4-(3-bromo-4-ethoxyphenyl)-4-oxobutanamide?
N-(5-benzyl-4-phenyl-1,3-thiazol-2-yl)-4-(3-bromo-4-ethoxyphenyl)-4-oxobutanamide has a molecular weight of 549.49 g/mol, XLogP of 7.16, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-benzyl-4-phenyl-1,3-thiazol-2-yl)-4-(3-bromo-4-ethoxyphenyl)-4-oxobutanamide is sourced from PubChem (CID 11856778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).