C26H22N4O4 — CID 118569262
6,13-bis(2-propan-2-yl-1H-imidazol-5-yl)-2,10-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4,6,8(16),11(15),12-hexaene-3,9-dione (PubChem CID 118569262) has the molecular formula C26H22N4O4 and a molecular weight of 454.49 g/mol. Its IUPAC name is 6,13-bis(2-propan-2-yl-1H-imidazol-5-yl)-2,10-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4,6,8(16),11(15),12-hexaene-3,9-dione.
| Compound Name | 6,13-bis(2-propan-2-yl-1H-imidazol-5-yl)-2,10-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4,6,8(16),11(15),12-hexaene-3,9-dione |
|---|---|
| PubChem CID | 118569262 |
| Molecular Formula | C26H22N4O4 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 6,13-bis(2-propan-2-yl-1H-imidazol-5-yl)-2,10-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4,6,8(16),11(15),12-hexaene-3,9-dione |
| SMILES | CC(C)c1ncc(-c2cc3oc(=O)c4cc(-c5cnc(C(C)C)[nH]5)cc5c(=O)oc(c2)c3c45)[nH]1 |
| InChI | InChI=1S/C26H22N4O4/c1-11(2)23-27-9-17(29-23)13-5-15-21-16(6-13)26(32)34-20-8-14(7-19(22(20)21)33-25(15)31)18-10-28-24(30-18)12(3)4/h5-12H,1-4H3,(H,27,29)(H,28,30) |
| InChIKey | LZPSDUPPSDKUHZ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|