C16H22N2O5 — CID 118570327
[(3S)-3-hydroxy-2-oxo-1-phenylpyrrolidin-3-yl] N-(1-methoxybutan-2-yl)carbamate (PubChem CID 118570327) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is [(3S)-3-hydroxy-2-oxo-1-phenylpyrrolidin-3-yl] N-(1-methoxybutan-2-yl)carbamate.
| Compound Name | [(3S)-3-hydroxy-2-oxo-1-phenylpyrrolidin-3-yl] N-(1-methoxybutan-2-yl)carbamate |
|---|---|
| PubChem CID | 118570327 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | [(3S)-3-hydroxy-2-oxo-1-phenylpyrrolidin-3-yl] N-(1-methoxybutan-2-yl)carbamate |
| SMILES | CCC(COC)NC(=O)O[C@@]1(O)CCN(c2ccccc2)C1=O |
| InChI | InChI=1S/C16H22N2O5/c1-3-12(11-22-2)17-15(20)23-16(21)9-10-18(14(16)19)13-7-5-4-6-8-13/h4-8,12,21H,3,9-11H2,1-2H3,(H,17,20)/t12?,16-/m0/s1 |
| InChIKey | GNNMUAJDIGSHEW-INSVYWFGSA-N |
| XLogP | 1.26 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|