C16H21N3O4 — CID 44581215
(5R)-N-methyl-3-[4-(1,4-oxazepan-4-yl)phenyl]-2-oxo-1,3-oxazolidine-5-carboxamide (PubChem CID 44581215) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is (5R)-N-methyl-3-[4-(1,4-oxazepan-4-yl)phenyl]-2-oxo-1,3-oxazolidine-5-carboxamide.
| Compound Name | (5R)-N-methyl-3-[4-(1,4-oxazepan-4-yl)phenyl]-2-oxo-1,3-oxazolidine-5-carboxamide |
|---|---|
| PubChem CID | 44581215 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | (5R)-N-methyl-3-[4-(1,4-oxazepan-4-yl)phenyl]-2-oxo-1,3-oxazolidine-5-carboxamide |
| SMILES | CNC(=O)[C@H]1CN(c2ccc(N3CCCOCC3)cc2)C(=O)O1 |
| InChI | InChI=1S/C16H21N3O4/c1-17-15(20)14-11-19(16(21)23-14)13-5-3-12(4-6-13)18-7-2-9-22-10-8-18/h3-6,14H,2,7-11H2,1H3,(H,17,20)/t14-/m1/s1 |
| InChIKey | QXWFAJAHYKLJHF-CQSZACIVSA-N |
| XLogP | 0.98 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|