C30H29ClN4O5 — CID 118573671
4-[5-chloro-2-[1-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]-4-oxoquinazolin-3-yl]butylcarbamic acid (PubChem CID 118573671) has the molecular formula C30H29ClN4O5 and a molecular weight of 561.04 g/mol. Its IUPAC name is 4-[5-chloro-2-[1-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]-4-oxoquinazolin-3-yl]butylcarbamic acid.
| Compound Name | 4-[5-chloro-2-[1-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]-4-oxoquinazolin-3-yl]butylcarbamic acid |
|---|---|
| PubChem CID | 118573671 |
| Molecular Formula | C30H29ClN4O5 |
| Molecular Weight | 561.04 g/mol |
| Exact Mass | 560.18 |
| IUPAC Name | 4-[5-chloro-2-[1-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]-4-oxoquinazolin-3-yl]butylcarbamic acid |
| SMILES | CC(NC(=O)OCC1c2ccccc2-c2ccccc21)c1nc2cccc(Cl)c2c(=O)n1CCCCNC(=O)O |
| InChI | InChI=1S/C30H29ClN4O5/c1-18(33-30(39)40-17-23-21-11-4-2-9-19(21)20-10-3-5-12-22(20)23)27-34-25-14-8-13-24(31)26(25)28(36)35(27)16-7-6-15-32-29(37)38/h2-5,8-14,18,23,32H,6-7,15-17H2,1H3,(H,33,39)(H,37,38) |
| InChIKey | WMGFWHHDXJPMRS-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.04 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|