About 8-hexoxyoctyl 9-hexoxy-2-hydroxynonane-1-sulfonate
8-hexoxyoctyl 9-hexoxy-2-hydroxynonane-1-sulfonate (PubChem CID 118575345) has the molecular formula C29H60O6S
and a molecular weight of 536.86 g/mol. Its IUPAC name is 8-hexoxyoctyl 9-hexoxy-2-hydroxynonane-1-sulfonate.
Molecular Properties
| Compound Name | 8-hexoxyoctyl 9-hexoxy-2-hydroxynonane-1-sulfonate |
| PubChem CID | 118575345 |
| Molecular Formula | C29H60O6S |
| Molecular Weight | 536.86 g/mol |
| Exact Mass | 536.41 |
| IUPAC Name | 8-hexoxyoctyl 9-hexoxy-2-hydroxynonane-1-sulfonate |
| SMILES | CCCCCCOCCCCCCCCOS(=O)(=O)CC(O)CCCCCCCOCCCCCC |
| InChI | InChI=1S/C29H60O6S/c1-3-5-7-17-23-33-25-19-13-9-10-15-21-27-35-36(31,32)28-29(30)22-16-12-11-14-20-26-34-24-18-8-6-4-2/h29-30H,3-28H2,1-2H3 |
| InChIKey | VYZQJSDIIVJNEX-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 536.86 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 8-hexoxyoctyl 9-hexoxy-2-hydroxynonane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-hexoxyoctyl 9-hexoxy-2-hydroxynonane-1-sulfonate?
The IUPAC name of 8-hexoxyoctyl 9-hexoxy-2-hydroxynonane-1-sulfonate (CID 118575345) is 8-hexoxyoctyl 9-hexoxy-2-hydroxynonane-1-sulfonate.
What is the SMILES notation for 8-hexoxyoctyl 9-hexoxy-2-hydroxynonane-1-sulfonate?
The canonical SMILES for 8-hexoxyoctyl 9-hexoxy-2-hydroxynonane-1-sulfonate is CCCCCCOCCCCCCCCOS(=O)(=O)CC(O)CCCCCCCOCCCCCC.
What is the InChIKey of 8-hexoxyoctyl 9-hexoxy-2-hydroxynonane-1-sulfonate?
The InChIKey is VYZQJSDIIVJNEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H60O6S/c1-3-5-7-17-23-33-25-19-13-9-10-15-21-27-35-36(31,32)28-29(30)22-16-12-11-14-20-26-34-24-18-8-6-4-2/h29-30H,3-28H2,1-2H3.
What are the key properties of 8-hexoxyoctyl 9-hexoxy-2-hydroxynonane-1-sulfonate?
8-hexoxyoctyl 9-hexoxy-2-hydroxynonane-1-sulfonate has a molecular weight of 536.86 g/mol, XLogP of 7.57, 30 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-hexoxyoctyl 9-hexoxy-2-hydroxynonane-1-sulfonate is sourced from PubChem (CID 118575345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).