About 6-butoxyhexyl 7-butoxy-2-hydroxyheptane-1-sulfonate
6-butoxyhexyl 7-butoxy-2-hydroxyheptane-1-sulfonate (PubChem CID 118575709) has the molecular formula C21H44O6S
and a molecular weight of 424.64 g/mol. Its IUPAC name is 6-butoxyhexyl 7-butoxy-2-hydroxyheptane-1-sulfonate.
Molecular Properties
| Compound Name | 6-butoxyhexyl 7-butoxy-2-hydroxyheptane-1-sulfonate |
| PubChem CID | 118575709 |
| Molecular Formula | C21H44O6S |
| Molecular Weight | 424.64 g/mol |
| Exact Mass | 424.29 |
| IUPAC Name | 6-butoxyhexyl 7-butoxy-2-hydroxyheptane-1-sulfonate |
| SMILES | CCCCOCCCCCCOS(=O)(=O)CC(O)CCCCCOCCCC |
| InChI | InChI=1S/C21H44O6S/c1-3-5-15-25-17-11-7-8-13-19-27-28(23,24)20-21(22)14-10-9-12-18-26-16-6-4-2/h21-22H,3-20H2,1-2H3 |
| InChIKey | FFRJGJNBMFKGRQ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.64 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 6-butoxyhexyl 7-butoxy-2-hydroxyheptane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butoxyhexyl 7-butoxy-2-hydroxyheptane-1-sulfonate?
The IUPAC name of 6-butoxyhexyl 7-butoxy-2-hydroxyheptane-1-sulfonate (CID 118575709) is 6-butoxyhexyl 7-butoxy-2-hydroxyheptane-1-sulfonate.
What is the SMILES notation for 6-butoxyhexyl 7-butoxy-2-hydroxyheptane-1-sulfonate?
The canonical SMILES for 6-butoxyhexyl 7-butoxy-2-hydroxyheptane-1-sulfonate is CCCCOCCCCCCOS(=O)(=O)CC(O)CCCCCOCCCC.
What is the InChIKey of 6-butoxyhexyl 7-butoxy-2-hydroxyheptane-1-sulfonate?
The InChIKey is FFRJGJNBMFKGRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H44O6S/c1-3-5-15-25-17-11-7-8-13-19-27-28(23,24)20-21(22)14-10-9-12-18-26-16-6-4-2/h21-22H,3-20H2,1-2H3.
What are the key properties of 6-butoxyhexyl 7-butoxy-2-hydroxyheptane-1-sulfonate?
6-butoxyhexyl 7-butoxy-2-hydroxyheptane-1-sulfonate has a molecular weight of 424.64 g/mol, XLogP of 4.45, 22 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butoxyhexyl 7-butoxy-2-hydroxyheptane-1-sulfonate is sourced from PubChem (CID 118575709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).