C19H30N4O6 — CID 118576572
(2,5-dioxopyrrolidin-1-yl) 3-[3-[(1-butan-2-ylpyrrolidine-2-carbonyl)amino]propanoylamino]propanoate (PubChem CID 118576572) has the molecular formula C19H30N4O6 and a molecular weight of 410.47 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[3-[(1-butan-2-ylpyrrolidine-2-carbonyl)amino]propanoylamino]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[3-[(1-butan-2-ylpyrrolidine-2-carbonyl)amino]propanoylamino]propanoate |
|---|---|
| PubChem CID | 118576572 |
| Molecular Formula | C19H30N4O6 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[3-[(1-butan-2-ylpyrrolidine-2-carbonyl)amino]propanoylamino]propanoate |
| SMILES | CCC(C)N1CCCC1C(=O)NCCC(=O)NCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C19H30N4O6/c1-3-13(2)22-12-4-5-14(22)19(28)21-10-8-15(24)20-11-9-18(27)29-23-16(25)6-7-17(23)26/h13-14H,3-12H2,1-2H3,(H,20,24)(H,21,28) |
| InChIKey | BVBLDORXVXPYLY-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|