C16H12N4O — CID 118577056
1-methoxy-7-pyrrolo[2,3-c]pyridin-1-yl-2,6-naphthyridine (PubChem CID 118577056) has the molecular formula C16H12N4O and a molecular weight of 276.30 g/mol. Its IUPAC name is 1-methoxy-7-pyrrolo[2,3-c]pyridin-1-yl-2,6-naphthyridine.
| Compound Name | 1-methoxy-7-pyrrolo[2,3-c]pyridin-1-yl-2,6-naphthyridine |
|---|---|
| PubChem CID | 118577056 |
| Molecular Formula | C16H12N4O |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 1-methoxy-7-pyrrolo[2,3-c]pyridin-1-yl-2,6-naphthyridine |
| SMILES | COc1nccc2cnc(-n3ccc4ccncc43)cc12 |
| InChI | InChI=1S/C16H12N4O/c1-21-16-13-8-15(19-9-12(13)3-6-18-16)20-7-4-11-2-5-17-10-14(11)20/h2-10H,1H3 |
| InChIKey | GJBFNSCALNZCOT-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |