C20H14ClN3O — CID 118577234
4-(2-chloro-4-pyridinyl)-8-phenyl-1,3-dihydro-1,5-benzodiazepin-2-one (PubChem CID 118577234) has the molecular formula C20H14ClN3O and a molecular weight of 347.81 g/mol. Its IUPAC name is 4-(2-chloro-4-pyridinyl)-8-phenyl-1,3-dihydro-1,5-benzodiazepin-2-one.
| Compound Name | 4-(2-chloro-4-pyridinyl)-8-phenyl-1,3-dihydro-1,5-benzodiazepin-2-one |
|---|---|
| PubChem CID | 118577234 |
| Molecular Formula | C20H14ClN3O |
| Molecular Weight | 347.81 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 4-(2-chloro-4-pyridinyl)-8-phenyl-1,3-dihydro-1,5-benzodiazepin-2-one |
| SMILES | O=C1CC(c2ccnc(Cl)c2)=Nc2ccc(-c3ccccc3)cc2N1 |
| InChI | InChI=1S/C20H14ClN3O/c21-19-11-15(8-9-22-19)17-12-20(25)24-18-10-14(6-7-16(18)23-17)13-4-2-1-3-5-13/h1-11H,12H2,(H,24,25) |
| InChIKey | DCRRRWIFRROONK-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.81 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|