C23H15N3O3 — CID 71284212
3-[4-(3-cyanophenyl)-2-oxo-1,3-dihydro-1,5-benzodiazepin-8-yl]benzoic acid (PubChem CID 71284212) has the molecular formula C23H15N3O3 and a molecular weight of 381.39 g/mol. Its IUPAC name is 3-[4-(3-cyanophenyl)-2-oxo-1,3-dihydro-1,5-benzodiazepin-8-yl]benzoic acid.
| Compound Name | 3-[4-(3-cyanophenyl)-2-oxo-1,3-dihydro-1,5-benzodiazepin-8-yl]benzoic acid |
|---|---|
| PubChem CID | 71284212 |
| Molecular Formula | C23H15N3O3 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 3-[4-(3-cyanophenyl)-2-oxo-1,3-dihydro-1,5-benzodiazepin-8-yl]benzoic acid |
| SMILES | N#Cc1cccc(C2=Nc3ccc(-c4cccc(C(=O)O)c4)cc3NC(=O)C2)c1 |
| InChI | InChI=1S/C23H15N3O3/c24-13-14-3-1-5-17(9-14)20-12-22(27)26-21-11-16(7-8-19(21)25-20)15-4-2-6-18(10-15)23(28)29/h1-11H,12H2,(H,26,27)(H,28,29) |
| InChIKey | CUIGHJJNLDKQIO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 102.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |