C24H18N2O2 — CID 22224730
4-(3-methoxyphenyl)-8-(2-phenylethynyl)-1,3-dihydro-1,5-benzodiazepin-2-one (PubChem CID 22224730) has the molecular formula C24H18N2O2 and a molecular weight of 366.42 g/mol. Its IUPAC name is 4-(3-methoxyphenyl)-8-(2-phenylethynyl)-1,3-dihydro-1,5-benzodiazepin-2-one.
| Compound Name | 4-(3-methoxyphenyl)-8-(2-phenylethynyl)-1,3-dihydro-1,5-benzodiazepin-2-one |
|---|---|
| PubChem CID | 22224730 |
| Molecular Formula | C24H18N2O2 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 4-(3-methoxyphenyl)-8-(2-phenylethynyl)-1,3-dihydro-1,5-benzodiazepin-2-one |
| SMILES | COc1cccc(C2=Nc3ccc(C#Cc4ccccc4)cc3NC(=O)C2)c1 |
| InChI | InChI=1S/C24H18N2O2/c1-28-20-9-5-8-19(15-20)22-16-24(27)26-23-14-18(12-13-21(23)25-22)11-10-17-6-3-2-4-7-17/h2-9,12-15H,16H2,1H3,(H,26,27) |
| InChIKey | DLLZKQWDMQYPFQ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|