C24H15F3IN3O — CID 162594614
4-[3-[2-(6-iodo-2-pyridinyl)ethynyl]phenyl]-7-methyl-8-(trifluoromethyl)-1,3-dihydro-1,5-benzodiazepin-2-one (PubChem CID 162594614) has the molecular formula C24H15F3IN3O and a molecular weight of 545.30 g/mol. Its IUPAC name is 4-[3-[2-(6-iodo-2-pyridinyl)ethynyl]phenyl]-7-methyl-8-(trifluoromethyl)-1,3-dihydro-1,5-benzodiazepin-2-one.
| Compound Name | 4-[3-[2-(6-iodo-2-pyridinyl)ethynyl]phenyl]-7-methyl-8-(trifluoromethyl)-1,3-dihydro-1,5-benzodiazepin-2-one |
|---|---|
| PubChem CID | 162594614 |
| Molecular Formula | C24H15F3IN3O |
| Molecular Weight | 545.30 g/mol |
| Exact Mass | 545.02 |
| IUPAC Name | 4-[3-[2-(6-iodo-2-pyridinyl)ethynyl]phenyl]-7-methyl-8-(trifluoromethyl)-1,3-dihydro-1,5-benzodiazepin-2-one |
| SMILES | Cc1cc2c(cc1C(F)(F)F)NC(=O)CC(c1cccc(C#Cc3cccc(I)n3)c1)=N2 |
| InChI | InChI=1S/C24H15F3IN3O/c1-14-10-20-21(12-18(14)24(25,26)27)31-23(32)13-19(30-20)16-5-2-4-15(11-16)8-9-17-6-3-7-22(28)29-17/h2-7,10-12H,13H2,1H3,(H,31,32) |
| InChIKey | KOIFOCIDQJAUQR-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.30 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|