C24H20F3N3O2 — CID 22317875
4-[3-(2,6-dimethyl-1-oxidopyridin-1-ium-4-yl)phenyl]-7-methyl-8-(trifluoromethyl)-1,3-dihydro-1,5-benzodiazepin-2-one (PubChem CID 22317875) has the molecular formula C24H20F3N3O2 and a molecular weight of 439.44 g/mol. Its IUPAC name is 4-[3-(2,6-dimethyl-1-oxidopyridin-1-ium-4-yl)phenyl]-7-methyl-8-(trifluoromethyl)-1,3-dihydro-1,5-benzodiazepin-2-one.
| Compound Name | 4-[3-(2,6-dimethyl-1-oxidopyridin-1-ium-4-yl)phenyl]-7-methyl-8-(trifluoromethyl)-1,3-dihydro-1,5-benzodiazepin-2-one |
|---|---|
| PubChem CID | 22317875 |
| Molecular Formula | C24H20F3N3O2 |
| Molecular Weight | 439.44 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 4-[3-(2,6-dimethyl-1-oxidopyridin-1-ium-4-yl)phenyl]-7-methyl-8-(trifluoromethyl)-1,3-dihydro-1,5-benzodiazepin-2-one |
| SMILES | Cc1cc2c(cc1C(F)(F)F)NC(=O)CC(c1cccc(-c3cc(C)[n+]([O-])c(C)c3)c1)=N2 |
| InChI | InChI=1S/C24H20F3N3O2/c1-13-7-21-22(11-19(13)24(25,26)27)29-23(31)12-20(28-21)17-6-4-5-16(10-17)18-8-14(2)30(32)15(3)9-18/h4-11H,12H2,1-3H3,(H,29,31) |
| InChIKey | GOUCDAKFXCVJJN-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 68.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.44 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|