C24H20F3N3O3 — CID 22317277
7-ethoxy-4-[3-(2-methyl-1-oxidopyridin-1-ium-4-yl)phenyl]-8-(trifluoromethyl)-1,3-dihydro-1,5-benzodiazepin-2-one (PubChem CID 22317277) has the molecular formula C24H20F3N3O3 and a molecular weight of 455.44 g/mol. Its IUPAC name is 7-ethoxy-4-[3-(2-methyl-1-oxidopyridin-1-ium-4-yl)phenyl]-8-(trifluoromethyl)-1,3-dihydro-1,5-benzodiazepin-2-one.
| Compound Name | 7-ethoxy-4-[3-(2-methyl-1-oxidopyridin-1-ium-4-yl)phenyl]-8-(trifluoromethyl)-1,3-dihydro-1,5-benzodiazepin-2-one |
|---|---|
| PubChem CID | 22317277 |
| Molecular Formula | C24H20F3N3O3 |
| Molecular Weight | 455.44 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 7-ethoxy-4-[3-(2-methyl-1-oxidopyridin-1-ium-4-yl)phenyl]-8-(trifluoromethyl)-1,3-dihydro-1,5-benzodiazepin-2-one |
| SMILES | CCOc1cc2c(cc1C(F)(F)F)NC(=O)CC(c1cccc(-c3cc[n+]([O-])c(C)c3)c1)=N2 |
| InChI | InChI=1S/C24H20F3N3O3/c1-3-33-22-12-21-20(11-18(22)24(25,26)27)29-23(31)13-19(28-21)17-6-4-5-15(10-17)16-7-8-30(32)14(2)9-16/h4-12H,3,13H2,1-2H3,(H,29,31) |
| InChIKey | VAOBYJHCSUWFGT-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.44 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|