C26H20N4O — CID 18613404
3-[7-(dimethylamino)-2-oxo-8-(2-phenylethynyl)-1,3-dihydro-1,5-benzodiazepin-4-yl]benzonitrile (PubChem CID 18613404) has the molecular formula C26H20N4O and a molecular weight of 404.47 g/mol. Its IUPAC name is 3-[7-(dimethylamino)-2-oxo-8-(2-phenylethynyl)-1,3-dihydro-1,5-benzodiazepin-4-yl]benzonitrile.
| Compound Name | 3-[7-(dimethylamino)-2-oxo-8-(2-phenylethynyl)-1,3-dihydro-1,5-benzodiazepin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 18613404 |
| Molecular Formula | C26H20N4O |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 3-[7-(dimethylamino)-2-oxo-8-(2-phenylethynyl)-1,3-dihydro-1,5-benzodiazepin-4-yl]benzonitrile |
| SMILES | CN(C)c1cc2c(cc1C#Cc1ccccc1)NC(=O)CC(c1cccc(C#N)c1)=N2 |
| InChI | InChI=1S/C26H20N4O/c1-30(2)25-15-24-23(14-21(25)12-11-18-7-4-3-5-8-18)29-26(31)16-22(28-24)20-10-6-9-19(13-20)17-27/h3-10,13-15H,16H2,1-2H3,(H,29,31) |
| InChIKey | JFHSXTVRMLNYBV-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 68.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|