C26H16N4O2 — CID 22448830
3-[7-(cyanomethoxy)-2-oxo-8-(2-phenylethynyl)-1,3-dihydro-1,5-benzodiazepin-4-yl]benzonitrile (PubChem CID 22448830) has the molecular formula C26H16N4O2 and a molecular weight of 416.44 g/mol. Its IUPAC name is 3-[7-(cyanomethoxy)-2-oxo-8-(2-phenylethynyl)-1,3-dihydro-1,5-benzodiazepin-4-yl]benzonitrile.
| Compound Name | 3-[7-(cyanomethoxy)-2-oxo-8-(2-phenylethynyl)-1,3-dihydro-1,5-benzodiazepin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 22448830 |
| Molecular Formula | C26H16N4O2 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 3-[7-(cyanomethoxy)-2-oxo-8-(2-phenylethynyl)-1,3-dihydro-1,5-benzodiazepin-4-yl]benzonitrile |
| SMILES | N#CCOc1cc2c(cc1C#Cc1ccccc1)NC(=O)CC(c1cccc(C#N)c1)=N2 |
| InChI | InChI=1S/C26H16N4O2/c27-11-12-32-25-15-24-23(14-21(25)10-9-18-5-2-1-3-6-18)30-26(31)16-22(29-24)20-8-4-7-19(13-20)17-28/h1-8,13-15H,12,16H2,(H,30,31) |
| InChIKey | NMVLUUKGEXUMHK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|