C20H27ClN4O3 — CID 118578181
tert-butyl 4-[2-(2-aminoethyl)-5-chloro-4-oxoquinazolin-3-yl]piperidine-1-carboxylate (PubChem CID 118578181) has the molecular formula C20H27ClN4O3 and a molecular weight of 406.91 g/mol. Its IUPAC name is tert-butyl 4-[2-(2-aminoethyl)-5-chloro-4-oxoquinazolin-3-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(2-aminoethyl)-5-chloro-4-oxoquinazolin-3-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 118578181 |
| Molecular Formula | C20H27ClN4O3 |
| Molecular Weight | 406.91 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | tert-butyl 4-[2-(2-aminoethyl)-5-chloro-4-oxoquinazolin-3-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(n2c(CCN)nc3cccc(Cl)c3c2=O)CC1 |
| InChI | InChI=1S/C20H27ClN4O3/c1-20(2,3)28-19(27)24-11-8-13(9-12-24)25-16(7-10-22)23-15-6-4-5-14(21)17(15)18(25)26/h4-6,13H,7-12,22H2,1-3H3 |
| InChIKey | XOLNFPLGEMWPRI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.91 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |