C20H28ClN5O3 — CID 118572146
tert-butyl 4-[2-(1-aminopropyl)-5-chloro-4-oxoquinazolin-3-yl]piperazine-1-carboxylate (PubChem CID 118572146) has the molecular formula C20H28ClN5O3 and a molecular weight of 421.93 g/mol. Its IUPAC name is tert-butyl 4-[2-(1-aminopropyl)-5-chloro-4-oxoquinazolin-3-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(1-aminopropyl)-5-chloro-4-oxoquinazolin-3-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 118572146 |
| Molecular Formula | C20H28ClN5O3 |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | tert-butyl 4-[2-(1-aminopropyl)-5-chloro-4-oxoquinazolin-3-yl]piperazine-1-carboxylate |
| SMILES | CCC(N)c1nc2cccc(Cl)c2c(=O)n1N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C20H28ClN5O3/c1-5-14(22)17-23-15-8-6-7-13(21)16(15)18(27)26(17)25-11-9-24(10-12-25)19(28)29-20(2,3)4/h6-8,14H,5,9-12,22H2,1-4H3 |
| InChIKey | NLJAYFITHRGUEL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 93.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |