C24H33N3O3 — CID 11857828
1-piperidin-1-yl-2-[2-[4-(3-piperidin-1-ylpropoxy)phenyl]-1,3-oxazol-4-yl]ethanone (PubChem CID 11857828) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is 1-piperidin-1-yl-2-[2-[4-(3-piperidin-1-ylpropoxy)phenyl]-1,3-oxazol-4-yl]ethanone.
| Compound Name | 1-piperidin-1-yl-2-[2-[4-(3-piperidin-1-ylpropoxy)phenyl]-1,3-oxazol-4-yl]ethanone |
|---|---|
| PubChem CID | 11857828 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | 1-piperidin-1-yl-2-[2-[4-(3-piperidin-1-ylpropoxy)phenyl]-1,3-oxazol-4-yl]ethanone |
| SMILES | O=C(Cc1coc(-c2ccc(OCCCN3CCCCC3)cc2)n1)N1CCCCC1 |
| InChI | InChI=1S/C24H33N3O3/c28-23(27-15-5-2-6-16-27)18-21-19-30-24(25-21)20-8-10-22(11-9-20)29-17-7-14-26-12-3-1-4-13-26/h8-11,19H,1-7,12-18H2 |
| InChIKey | REBYTCGTMZRZBI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|