C15H16N2O3 — CID 38549400
1-morpholin-4-yl-2-(2-phenyl-1,3-oxazol-4-yl)ethanone (PubChem CID 38549400) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is 1-morpholin-4-yl-2-(2-phenyl-1,3-oxazol-4-yl)ethanone.
| Compound Name | 1-morpholin-4-yl-2-(2-phenyl-1,3-oxazol-4-yl)ethanone |
|---|---|
| PubChem CID | 38549400 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 1-morpholin-4-yl-2-(2-phenyl-1,3-oxazol-4-yl)ethanone |
| SMILES | O=C(Cc1coc(-c2ccccc2)n1)N1CCOCC1 |
| InChI | InChI=1S/C15H16N2O3/c18-14(17-6-8-19-9-7-17)10-13-11-20-15(16-13)12-4-2-1-3-5-12/h1-5,11H,6-10H2 |
| InChIKey | QDXPGJQWNGZQCC-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |