C18H21N3O3 — CID 95160386
2-[(2S)-1-[2-(2-phenyl-1,3-oxazol-4-yl)acetyl]piperidin-2-yl]acetamide (PubChem CID 95160386) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is 2-[(2S)-1-[2-(2-phenyl-1,3-oxazol-4-yl)acetyl]piperidin-2-yl]acetamide.
| Compound Name | 2-[(2S)-1-[2-(2-phenyl-1,3-oxazol-4-yl)acetyl]piperidin-2-yl]acetamide |
|---|---|
| PubChem CID | 95160386 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 2-[(2S)-1-[2-(2-phenyl-1,3-oxazol-4-yl)acetyl]piperidin-2-yl]acetamide |
| SMILES | NC(=O)C[C@@H]1CCCCN1C(=O)Cc1coc(-c2ccccc2)n1 |
| InChI | InChI=1S/C18H21N3O3/c19-16(22)11-15-8-4-5-9-21(15)17(23)10-14-12-24-18(20-14)13-6-2-1-3-7-13/h1-3,6-7,12,15H,4-5,8-11H2,(H2,19,22)/t15-/m0/s1 |
| InChIKey | RWDPWMLLDXEZHB-HNNXBMFYSA-N |
| XLogP | 2.14 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |