C30H48O5 — CID 118579714
[(3S)-1-[(2E)-2-[(3aS,7aR)-1-[(E,2R,5S)-6-hydroxy-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]-1-methoxyethyl]-2-hydroxy-3-bicyclo[3.1.0]hexanyl] acetate (PubChem CID 118579714) has the molecular formula C30H48O5 and a molecular weight of 488.71 g/mol. Its IUPAC name is [(3S)-1-[(2E)-2-[(3aS,7aR)-1-[(E,2R,5S)-6-hydroxy-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]-1-methoxyethyl]-2-hydroxy-3-bicyclo[3.1.0]hexanyl] acetate.
| Compound Name | [(3S)-1-[(2E)-2-[(3aS,7aR)-1-[(E,2R,5S)-6-hydroxy-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]-1-methoxyethyl]-2-hydroxy-3-bicyclo[3.1.0]hexanyl] acetate |
|---|---|
| PubChem CID | 118579714 |
| Molecular Formula | C30H48O5 |
| Molecular Weight | 488.71 g/mol |
| Exact Mass | 488.35 |
| IUPAC Name | [(3S)-1-[(2E)-2-[(3aS,7aR)-1-[(E,2R,5S)-6-hydroxy-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]-1-methoxyethyl]-2-hydroxy-3-bicyclo[3.1.0]hexanyl] acetate |
| SMILES | COC(/C=C1\CCC[C@]2(C)C([C@H](C)/C=C/[C@H](C)C(C)(C)O)CC[C@@H]12)C12CC1C[C@H](OC(C)=O)C2O |
| InChI | InChI=1S/C30H48O5/c1-18(10-11-19(2)28(4,5)33)23-12-13-24-21(9-8-14-29(23,24)6)15-26(34-7)30-17-22(30)16-25(27(30)32)35-20(3)31/h10-11,15,18-19,22-27,32-33H,8-9,12-14,16-17H2,1-7H3/b11-10+,21-15+/t18-,19+,22?,23?,24+,25+,26?,27?,29-,30?/m1/s1 |
| InChIKey | KGTPFSQCHFBXIE-OMKOMLOESA-N |
| XLogP | 5.45 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.71 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|