C17H14BrNS — CID 118581123
4-bromo-5-methyl-N,N-diphenylthiophen-2-amine (PubChem CID 118581123) has the molecular formula C17H14BrNS and a molecular weight of 344.28 g/mol. Its IUPAC name is 4-bromo-5-methyl-N,N-diphenylthiophen-2-amine.
| Compound Name | 4-bromo-5-methyl-N,N-diphenylthiophen-2-amine |
|---|---|
| PubChem CID | 118581123 |
| Molecular Formula | C17H14BrNS |
| Molecular Weight | 344.28 g/mol |
| Exact Mass | 343.00 |
| IUPAC Name | 4-bromo-5-methyl-N,N-diphenylthiophen-2-amine |
| SMILES | Cc1sc(N(c2ccccc2)c2ccccc2)cc1Br |
| InChI | InChI=1S/C17H14BrNS/c1-13-16(18)12-17(20-13)19(14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-12H,1H3 |
| InChIKey | LIRXJZYRNPWDCI-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.28 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |