C58H44N6S2 — CID 138489029
N,N-diphenyl-5-[4-[2,3,7,8-tetramethyl-5-[4-[5-(N-phenylanilino)thiophen-2-yl]phenyl]pyrazino[2,3-g]quinoxalin-10-yl]phenyl]thiophen-2-amine (PubChem CID 138489029) has the molecular formula C58H44N6S2 and a molecular weight of 889.17 g/mol. Its IUPAC name is N,N-diphenyl-5-[4-[2,3,7,8-tetramethyl-5-[4-[5-(N-phenylanilino)thiophen-2-yl]phenyl]pyrazino[2,3-g]quinoxalin-10-yl]phenyl]thiophen-2-amine.
| Compound Name | N,N-diphenyl-5-[4-[2,3,7,8-tetramethyl-5-[4-[5-(N-phenylanilino)thiophen-2-yl]phenyl]pyrazino[2,3-g]quinoxalin-10-yl]phenyl]thiophen-2-amine |
|---|---|
| PubChem CID | 138489029 |
| Molecular Formula | C58H44N6S2 |
| Molecular Weight | 889.17 g/mol |
| Exact Mass | 888.31 |
| IUPAC Name | N,N-diphenyl-5-[4-[2,3,7,8-tetramethyl-5-[4-[5-(N-phenylanilino)thiophen-2-yl]phenyl]pyrazino[2,3-g]quinoxalin-10-yl]phenyl]thiophen-2-amine |
| SMILES | Cc1nc2c(-c3ccc(-c4ccc(N(c5ccccc5)c5ccccc5)s4)cc3)c3nc(C)c(C)nc3c(-c3ccc(-c4ccc(N(c5ccccc5)c5ccccc5)s4)cc3)c2nc1C |
| InChI | InChI=1S/C58H44N6S2/c1-37-38(2)60-56-54(44-31-27-42(28-32-44)50-34-36-52(66-50)64(47-21-13-7-14-22-47)48-23-15-8-16-24-48)58-57(61-39(3)40(4)62-58)53(55(56)59-37)43-29-25-41(26-30-43)49-33-35-51(65-49)63(45-17-9-5-10-18-45)46-19-11-6-12-20-46/h5-36H,1-4H3 |
| InChIKey | HOMGUTYZCUDELN-UHFFFAOYSA-N |
| XLogP | 16.54 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 889.17 |
| LogP ≤ 5 | 16.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|