C17H19NO2 — CID 118581284
1-(5-methylisoquinolin-4-yl)heptane-1,6-dione (PubChem CID 118581284) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is 1-(5-methylisoquinolin-4-yl)heptane-1,6-dione.
| Compound Name | 1-(5-methylisoquinolin-4-yl)heptane-1,6-dione |
|---|---|
| PubChem CID | 118581284 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 1-(5-methylisoquinolin-4-yl)heptane-1,6-dione |
| SMILES | CC(=O)CCCCC(=O)c1cncc2cccc(C)c12 |
| InChI | InChI=1S/C17H19NO2/c1-12-6-5-8-14-10-18-11-15(17(12)14)16(20)9-4-3-7-13(2)19/h5-6,8,10-11H,3-4,7,9H2,1-2H3 |
| InChIKey | UPWFNVPXRHBWSB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|