About dimethyl nona-2,7-diynedioate
dimethyl nona-2,7-diynedioate (PubChem CID 11858703) has the molecular formula C11H12O4
and a molecular weight of 208.21 g/mol. Its IUPAC name is dimethyl nona-2,7-diynedioate.
Molecular Properties
| Compound Name | dimethyl nona-2,7-diynedioate |
| PubChem CID | 11858703 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | dimethyl nona-2,7-diynedioate |
| SMILES | COC(=O)C#CCCCC#CC(=O)OC |
| InChI | InChI=1S/C11H12O4/c1-14-10(12)8-6-4-3-5-7-9-11(13)15-2/h3-5H2,1-2H3 |
| InChIKey | ZUARVALOAGVZPK-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze dimethyl nona-2,7-diynedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl nona-2,7-diynedioate?
The IUPAC name of dimethyl nona-2,7-diynedioate (CID 11858703) is dimethyl nona-2,7-diynedioate.
What is the SMILES notation for dimethyl nona-2,7-diynedioate?
The canonical SMILES for dimethyl nona-2,7-diynedioate is COC(=O)C#CCCCC#CC(=O)OC.
What is the InChIKey of dimethyl nona-2,7-diynedioate?
The InChIKey is ZUARVALOAGVZPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O4/c1-14-10(12)8-6-4-3-5-7-9-11(13)15-2/h3-5H2,1-2H3.
What are the key properties of dimethyl nona-2,7-diynedioate?
dimethyl nona-2,7-diynedioate has a molecular weight of 208.21 g/mol, XLogP of 0.51, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl nona-2,7-diynedioate is sourced from PubChem (CID 11858703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).