About methyl hex-2-enoate;methyl oct-2-ynoate
methyl hex-2-enoate;methyl oct-2-ynoate (PubChem CID 174923116) has the molecular formula C16H26O4
and a molecular weight of 282.38 g/mol. Its IUPAC name is methyl hex-2-enoate;methyl oct-2-ynoate.
Molecular Properties
| Compound Name | methyl hex-2-enoate;methyl oct-2-ynoate |
| PubChem CID | 174923116 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | methyl hex-2-enoate;methyl oct-2-ynoate |
| SMILES | CCCC=CC(=O)OC.CCCCCC#CC(=O)OC |
| InChI | InChI=1S/C9H14O2.C7H12O2/c1-3-4-5-6-7-8-9(10)11-2;1-3-4-5-6-7(8)9-2/h3-6H2,1-2H3;5-6H,3-4H2,1-2H3 |
| InChIKey | FWLYJKMLMPFIIG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl hex-2-enoate;methyl oct-2-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl hex-2-enoate;methyl oct-2-ynoate?
The IUPAC name of methyl hex-2-enoate;methyl oct-2-ynoate (CID 174923116) is methyl hex-2-enoate;methyl oct-2-ynoate.
What is the SMILES notation for methyl hex-2-enoate;methyl oct-2-ynoate?
The canonical SMILES for methyl hex-2-enoate;methyl oct-2-ynoate is CCCC=CC(=O)OC.CCCCCC#CC(=O)OC.
What is the InChIKey of methyl hex-2-enoate;methyl oct-2-ynoate?
The InChIKey is FWLYJKMLMPFIIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O2.C7H12O2/c1-3-4-5-6-7-8-9(10)11-2;1-3-4-5-6-7(8)9-2/h3-6H2,1-2H3;5-6H,3-4H2,1-2H3.
What are the key properties of methyl hex-2-enoate;methyl oct-2-ynoate?
methyl hex-2-enoate;methyl oct-2-ynoate has a molecular weight of 282.38 g/mol, XLogP of 3.26, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl hex-2-enoate;methyl oct-2-ynoate is sourced from PubChem (CID 174923116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).