C24H36 — CID 101157076
(E)-7,8-bis[(E)-pent-1-enyl]tetradec-7-en-5,9-diyne (PubChem CID 101157076) has the molecular formula C24H36 and a molecular weight of 324.55 g/mol. Its IUPAC name is (E)-7,8-bis[(E)-pent-1-enyl]tetradec-7-en-5,9-diyne.
| Compound Name | (E)-7,8-bis[(E)-pent-1-enyl]tetradec-7-en-5,9-diyne |
|---|---|
| PubChem CID | 101157076 |
| Molecular Formula | C24H36 |
| Molecular Weight | 324.55 g/mol |
| Exact Mass | 324.28 |
| IUPAC Name | (E)-7,8-bis[(E)-pent-1-enyl]tetradec-7-en-5,9-diyne |
| SMILES | CCC/C=C/C(C#CCCCC)=C(C#CCCCC)/C=C/CCC |
| InChI | InChI=1S/C24H36/c1-5-9-13-17-21-23(19-15-11-7-3)24(20-16-12-8-4)22-18-14-10-6-2/h15-16,19-20H,5-14H2,1-4H3/b19-15+,20-16+,24-23+ |
| InChIKey | IXANDHIZCLWYKV-PKYXWRJPSA-N |
| XLogP | 7.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.55 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|