C15H18BrN — CID 155468158
(Z)-3-[(1Z)-3-bromobuta-1,3-dienyl]-2-ethylnon-2-en-4-ynenitrile (PubChem CID 155468158) has the molecular formula C15H18BrN and a molecular weight of 292.22 g/mol. Its IUPAC name is (Z)-3-[(1Z)-3-bromobuta-1,3-dienyl]-2-ethylnon-2-en-4-ynenitrile.
| Compound Name | (Z)-3-[(1Z)-3-bromobuta-1,3-dienyl]-2-ethylnon-2-en-4-ynenitrile |
|---|---|
| PubChem CID | 155468158 |
| Molecular Formula | C15H18BrN |
| Molecular Weight | 292.22 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | (Z)-3-[(1Z)-3-bromobuta-1,3-dienyl]-2-ethylnon-2-en-4-ynenitrile |
| SMILES | C=C(Br)/C=C\C(C#CCCCC)=C(\C#N)CC |
| InChI | InChI=1S/C15H18BrN/c1-4-6-7-8-9-15(11-10-13(3)16)14(5-2)12-17/h10-11H,3-7H2,1-2H3/b11-10-,15-14+ |
| InChIKey | QTTWUOCLHPDJJN-HHAKQIEWSA-N |
| XLogP | 4.87 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.22 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|