About (Z)-5,6-bis(prop-2-enyl)dodec-5-en-7-yne
(Z)-5,6-bis(prop-2-enyl)dodec-5-en-7-yne (PubChem CID 102258768) has the molecular formula C18H28
and a molecular weight of 244.42 g/mol. Its IUPAC name is (Z)-5,6-bis(prop-2-enyl)dodec-5-en-7-yne.
Molecular Properties
| Compound Name | (Z)-5,6-bis(prop-2-enyl)dodec-5-en-7-yne |
| PubChem CID | 102258768 |
| Molecular Formula | C18H28 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | (Z)-5,6-bis(prop-2-enyl)dodec-5-en-7-yne |
| SMILES | C=CC/C(C#CCCCC)=C(/CC=C)CCCC |
| InChI | InChI=1S/C18H28/c1-5-9-11-12-16-18(14-8-4)17(13-7-3)15-10-6-2/h7-8H,3-6,9-11,13-15H2,1-2H3/b18-17+ |
| InChIKey | KDQBUSDZEKZXLB-ISLYRVAYSA-N |
| XLogP | 5.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-5,6-bis(prop-2-enyl)dodec-5-en-7-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-5,6-bis(prop-2-enyl)dodec-5-en-7-yne?
The IUPAC name of (Z)-5,6-bis(prop-2-enyl)dodec-5-en-7-yne (CID 102258768) is (Z)-5,6-bis(prop-2-enyl)dodec-5-en-7-yne.
What is the SMILES notation for (Z)-5,6-bis(prop-2-enyl)dodec-5-en-7-yne?
The canonical SMILES for (Z)-5,6-bis(prop-2-enyl)dodec-5-en-7-yne is C=CC/C(C#CCCCC)=C(/CC=C)CCCC.
What is the InChIKey of (Z)-5,6-bis(prop-2-enyl)dodec-5-en-7-yne?
The InChIKey is KDQBUSDZEKZXLB-ISLYRVAYSA-N. The full InChI is InChI=1S/C18H28/c1-5-9-11-12-16-18(14-8-4)17(13-7-3)15-10-6-2/h7-8H,3-6,9-11,13-15H2,1-2H3/b18-17+.
What are the key properties of (Z)-5,6-bis(prop-2-enyl)dodec-5-en-7-yne?
(Z)-5,6-bis(prop-2-enyl)dodec-5-en-7-yne has a molecular weight of 244.42 g/mol, XLogP of 5.82, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-5,6-bis(prop-2-enyl)dodec-5-en-7-yne is sourced from PubChem (CID 102258768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).