C18H29I — CID 10981553
(3Z,5Z)-4,5,6-triethyl-3-iodododeca-3,5-dien-7-yne (PubChem CID 10981553) has the molecular formula C18H29I and a molecular weight of 372.33 g/mol. Its IUPAC name is (3Z,5Z)-4,5,6-triethyl-3-iodododeca-3,5-dien-7-yne.
| Compound Name | (3Z,5Z)-4,5,6-triethyl-3-iodododeca-3,5-dien-7-yne |
|---|---|
| PubChem CID | 10981553 |
| Molecular Formula | C18H29I |
| Molecular Weight | 372.33 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | (3Z,5Z)-4,5,6-triethyl-3-iodododeca-3,5-dien-7-yne |
| SMILES | CCCCC#C/C(CC)=C(CC)\C(CC)=C(/I)CC |
| InChI | InChI=1S/C18H29I/c1-6-11-12-13-14-15(7-2)16(8-3)17(9-4)18(19)10-5/h6-12H2,1-5H3/b16-15-,18-17- |
| InChIKey | AZJPDZDFDMCLDU-IUILNFPDSA-N |
| XLogP | 6.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.33 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|