About 8-butyl-7-hex-1-ynylpentadec-7-en-5,9-diyne
8-butyl-7-hex-1-ynylpentadec-7-en-5,9-diyne (PubChem CID 135010412) has the molecular formula C25H38
and a molecular weight of 338.58 g/mol. Its IUPAC name is 8-butyl-7-hex-1-ynylpentadec-7-en-5,9-diyne.
Molecular Properties
| Compound Name | 8-butyl-7-hex-1-ynylpentadec-7-en-5,9-diyne |
| PubChem CID | 135010412 |
| Molecular Formula | C25H38 |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 338.30 |
| IUPAC Name | 8-butyl-7-hex-1-ynylpentadec-7-en-5,9-diyne |
| SMILES | CCCCC#CC(C#CCCCC)=C(C#CCCCCC)CCCC |
| InChI | InChI=1S/C25H38/c1-5-9-13-16-19-23-24(20-12-8-4)25(21-17-14-10-6-2)22-18-15-11-7-3/h5-16,20H2,1-4H3 |
| InChIKey | SIDIUUZSLPRSDQ-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-butyl-7-hex-1-ynylpentadec-7-en-5,9-diyne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-butyl-7-hex-1-ynylpentadec-7-en-5,9-diyne?
The IUPAC name of 8-butyl-7-hex-1-ynylpentadec-7-en-5,9-diyne (CID 135010412) is 8-butyl-7-hex-1-ynylpentadec-7-en-5,9-diyne.
What is the SMILES notation for 8-butyl-7-hex-1-ynylpentadec-7-en-5,9-diyne?
The canonical SMILES for 8-butyl-7-hex-1-ynylpentadec-7-en-5,9-diyne is CCCCC#CC(C#CCCCC)=C(C#CCCCCC)CCCC.
What is the InChIKey of 8-butyl-7-hex-1-ynylpentadec-7-en-5,9-diyne?
The InChIKey is SIDIUUZSLPRSDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H38/c1-5-9-13-16-19-23-24(20-12-8-4)25(21-17-14-10-6-2)22-18-15-11-7-3/h5-16,20H2,1-4H3.
What are the key properties of 8-butyl-7-hex-1-ynylpentadec-7-en-5,9-diyne?
8-butyl-7-hex-1-ynylpentadec-7-en-5,9-diyne has a molecular weight of 338.58 g/mol, XLogP of 7.44, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 8-butyl-7-hex-1-ynylpentadec-7-en-5,9-diyne is sourced from PubChem (CID 135010412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).