About CID 136834987
CID 136834987 (PubChem CID 136834987) has the molecular formula C16H27BSi
and a molecular weight of 258.29 g/mol.
Molecular Properties
| Compound Name | CID 136834987 |
| PubChem CID | 136834987 |
| Molecular Formula | C16H27BSi |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | — |
| SMILES | C=CCB(CC=C)/C([Si]C)=C(\CC=C)CCCC |
| InChI | InChI=1S/C16H27BSi/c1-6-10-12-15(11-7-2)16(18-5)17(13-8-3)14-9-4/h7-9H,2-4,6,10-14H2,1,5H3/b16-15- |
| InChIKey | PPISRJYNXXZNRE-NXVVXOECSA-N |
| XLogP | 5.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 136834987 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 136834987?
The IUPAC name of CID 136834987 (CID 136834987) is not available.
What is the SMILES notation for CID 136834987?
The canonical SMILES for CID 136834987 is C=CCB(CC=C)/C([Si]C)=C(\CC=C)CCCC.
What is the InChIKey of CID 136834987?
The InChIKey is PPISRJYNXXZNRE-NXVVXOECSA-N. The full InChI is InChI=1S/C16H27BSi/c1-6-10-12-15(11-7-2)16(18-5)17(13-8-3)14-9-4/h7-9H,2-4,6,10-14H2,1,5H3/b16-15-.
What are the key properties of CID 136834987?
CID 136834987 has a molecular weight of 258.29 g/mol, XLogP of 5.17, 11 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 136834987 is sourced from PubChem (CID 136834987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).