C16H30Si — CID 11172756
[(1Z)-2-butyl-3-propan-2-ylidenehexa-1,5-dienyl]-trimethylsilane (PubChem CID 11172756) has the molecular formula C16H30Si and a molecular weight of 250.50 g/mol. Its IUPAC name is [(1Z)-2-butyl-3-propan-2-ylidenehexa-1,5-dienyl]-trimethylsilane.
| Compound Name | [(1Z)-2-butyl-3-propan-2-ylidenehexa-1,5-dienyl]-trimethylsilane |
|---|---|
| PubChem CID | 11172756 |
| Molecular Formula | C16H30Si |
| Molecular Weight | 250.50 g/mol |
| Exact Mass | 250.21 |
| IUPAC Name | [(1Z)-2-butyl-3-propan-2-ylidenehexa-1,5-dienyl]-trimethylsilane |
| SMILES | C=CCC(=C(C)C)/C(=C\[Si](C)(C)C)CCCC |
| InChI | InChI=1S/C16H30Si/c1-8-10-12-15(13-17(5,6)7)16(11-9-2)14(3)4/h9,13H,2,8,10-12H2,1,3-7H3/b15-13- |
| InChIKey | WLABGHIISLAHQT-SQFISAMPSA-N |
| XLogP | 5.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.50 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|