C12H16O — CID 134857744
(2E,4E)-dodeca-2,4-dien-7-yn-6-one (PubChem CID 134857744) has the molecular formula C12H16O and a molecular weight of 176.26 g/mol. Its IUPAC name is (2E,4E)-dodeca-2,4-dien-7-yn-6-one.
| Compound Name | (2E,4E)-dodeca-2,4-dien-7-yn-6-one |
|---|---|
| PubChem CID | 134857744 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | (2E,4E)-dodeca-2,4-dien-7-yn-6-one |
| SMILES | C/C=C/C=C/C(=O)C#CCCCC |
| InChI | InChI=1S/C12H16O/c1-3-5-7-9-11-12(13)10-8-6-4-2/h4,6,8,10H,3,5,7H2,1-2H3/b6-4+,10-8+ |
| InChIKey | XLRGYJCJXNLTQT-ONNLMXTPSA-N |
| XLogP | 2.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|