C50H72 — CID 141370048
6-but-1-ynyl-7-but-3-ynyl-8-hept-1-enyl-9-hept-1-ynyl-7-hex-1-ynyl-6-pent-1-ynylheptadeca-4,8-dien-10-yne (PubChem CID 141370048) has the molecular formula C50H72 and a molecular weight of 673.13 g/mol. Its IUPAC name is 6-but-1-ynyl-7-but-3-ynyl-8-hept-1-enyl-9-hept-1-ynyl-7-hex-1-ynyl-6-pent-1-ynylheptadeca-4,8-dien-10-yne.
| Compound Name | 6-but-1-ynyl-7-but-3-ynyl-8-hept-1-enyl-9-hept-1-ynyl-7-hex-1-ynyl-6-pent-1-ynylheptadeca-4,8-dien-10-yne |
|---|---|
| PubChem CID | 141370048 |
| Molecular Formula | C50H72 |
| Molecular Weight | 673.13 g/mol |
| Exact Mass | 672.56 |
| IUPAC Name | 6-but-1-ynyl-7-but-3-ynyl-8-hept-1-enyl-9-hept-1-ynyl-7-hex-1-ynyl-6-pent-1-ynylheptadeca-4,8-dien-10-yne |
| SMILES | C#CCCC(C#CCCCC)(C(C=CCCCCC)=C(C#CCCCCC)C#CCCCCCC)C(C#CCC)(C#CCCC)C=CCCC |
| InChI | InChI=1S/C50H72/c1-9-17-25-29-32-34-40-47(39-33-30-26-18-10-2)48(41-35-31-27-19-11-3)50(45-24-16-8,46-38-28-20-12-4)49(42-23-15-7,43-36-21-13-5)44-37-22-14-6/h8,35-36,41,43H,9-15,17-22,24-32,45H2,1-7H3 |
| InChIKey | ANPQHNKUARUFQU-UHFFFAOYSA-N |
| XLogP | 14.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 22 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.13 |
| LogP ≤ 5 | 14.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|