C15H22O2 — CID 134987425
6-butylideneundeca-4,7-diyne-1,11-diol (PubChem CID 134987425) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is 6-butylideneundeca-4,7-diyne-1,11-diol.
| Compound Name | 6-butylideneundeca-4,7-diyne-1,11-diol |
|---|---|
| PubChem CID | 134987425 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 6-butylideneundeca-4,7-diyne-1,11-diol |
| SMILES | CCCC=C(C#CCCCO)C#CCCCO |
| InChI | InChI=1S/C15H22O2/c1-2-3-10-15(11-6-4-8-13-16)12-7-5-9-14-17/h10,16-17H,2-5,8-9,13-14H2,1H3 |
| InChIKey | UEWIQASGZBPFGD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|