C28H35AuF3N3O3S — CID 11858840
4-tert-butyl-2,6-bis(4-tert-butyl-2-pyridinyl)pyridine;gold(1+);trifluoromethanesulfonate (PubChem CID 11858840) has the molecular formula C28H35AuF3N3O3S and a molecular weight of 747.63 g/mol. Its IUPAC name is 4-tert-butyl-2,6-bis(4-tert-butyl-2-pyridinyl)pyridine;gold(1+);trifluoromethanesulfonate.
| Compound Name | 4-tert-butyl-2,6-bis(4-tert-butyl-2-pyridinyl)pyridine;gold(1+);trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11858840 |
| Molecular Formula | C28H35AuF3N3O3S |
| Molecular Weight | 747.63 g/mol |
| Exact Mass | 747.20 |
| IUPAC Name | 4-tert-butyl-2,6-bis(4-tert-butyl-2-pyridinyl)pyridine;gold(1+);trifluoromethanesulfonate |
| SMILES | CC(C)(C)c1ccnc(-c2cc(C(C)(C)C)cc(-c3cc(C(C)(C)C)ccn3)n2)c1.O=S(=O)([O-])C(F)(F)F.[Au+] |
| InChI | InChI=1S/C27H35N3.CHF3O3S.Au/c1-25(2,3)18-10-12-28-21(14-18)23-16-20(27(7,8)9)17-24(30-23)22-15-19(11-13-29-22)26(4,5)6;2-1(3,4)8(5,6)7;/h10-17H,1-9H3;(H,5,6,7);/q;;+1/p-1 |
| InChIKey | XMHSUWZFVOKJRJ-UHFFFAOYSA-M |
| XLogP | 7.15 |
| TPSA | 95.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.63 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|